About 4-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine
4-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine (PubChem CID 60588527) has the molecular formula C10H17N3OS2
and a molecular weight of 259.40 g/mol. Its IUPAC name is 4-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine.
Molecular Properties
| Compound Name | 4-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine |
| PubChem CID | 60588527 |
| Molecular Formula | C10H17N3OS2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 4-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine |
| SMILES | CCCCSc1nnc(N2CCOCC2)s1 |
| InChI | InChI=1S/C10H17N3OS2/c1-2-3-8-15-10-12-11-9(16-10)13-4-6-14-7-5-13/h2-8H2,1H3 |
| InChIKey | ZQODLRZHEFWTMD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine?
The IUPAC name of 4-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine (CID 60588527) is 4-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine.
What is the SMILES notation for 4-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine?
The canonical SMILES for 4-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine is CCCCSc1nnc(N2CCOCC2)s1.
What is the InChIKey of 4-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine?
The InChIKey is ZQODLRZHEFWTMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3OS2/c1-2-3-8-15-10-12-11-9(16-10)13-4-6-14-7-5-13/h2-8H2,1H3.
What are the key properties of 4-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine?
4-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine has a molecular weight of 259.40 g/mol, XLogP of 2.27, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)morpholine is sourced from PubChem (CID 60588527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).