C15H19ClFNO4S — CID 60588940
ethyl 3-[(3-chloro-4-fluorophenyl)sulfonyl-(cyclopropylmethyl)amino]propanoate (PubChem CID 60588940) has the molecular formula C15H19ClFNO4S and a molecular weight of 363.84 g/mol. Its IUPAC name is ethyl 3-[(3-chloro-4-fluorophenyl)sulfonyl-(cyclopropylmethyl)amino]propanoate.
| Compound Name | ethyl 3-[(3-chloro-4-fluorophenyl)sulfonyl-(cyclopropylmethyl)amino]propanoate |
|---|---|
| PubChem CID | 60588940 |
| Molecular Formula | C15H19ClFNO4S |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | ethyl 3-[(3-chloro-4-fluorophenyl)sulfonyl-(cyclopropylmethyl)amino]propanoate |
| SMILES | CCOC(=O)CCN(CC1CC1)S(=O)(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H19ClFNO4S/c1-2-22-15(19)7-8-18(10-11-3-4-11)23(20,21)12-5-6-14(17)13(16)9-12/h5-6,9,11H,2-4,7-8,10H2,1H3 |
| InChIKey | AZJLWYUCISLVOS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |