C17H30N2O3 — CID 60590203
N,N,2,2-tetramethyl-N'-[(2,4,5-trimethoxyphenyl)methyl]propane-1,3-diamine (PubChem CID 60590203) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is N,N,2,2-tetramethyl-N'-[(2,4,5-trimethoxyphenyl)methyl]propane-1,3-diamine.
| Compound Name | N,N,2,2-tetramethyl-N'-[(2,4,5-trimethoxyphenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 60590203 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | N,N,2,2-tetramethyl-N'-[(2,4,5-trimethoxyphenyl)methyl]propane-1,3-diamine |
| SMILES | COc1cc(OC)c(OC)cc1CNCC(C)(C)CN(C)C |
| InChI | InChI=1S/C17H30N2O3/c1-17(2,12-19(3)4)11-18-10-13-8-15(21-6)16(22-7)9-14(13)20-5/h8-9,18H,10-12H2,1-7H3 |
| InChIKey | VUTLRKIXBGMHCJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |