C11H14Cl2N2O2 — CID 60591458
1-(3,5-dichloro-4-methylphenyl)-3-(2-methoxyethyl)urea (PubChem CID 60591458) has the molecular formula C11H14Cl2N2O2 and a molecular weight of 277.15 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-methylphenyl)-3-(2-methoxyethyl)urea.
| Compound Name | 1-(3,5-dichloro-4-methylphenyl)-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 60591458 |
| Molecular Formula | C11H14Cl2N2O2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 1-(3,5-dichloro-4-methylphenyl)-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)Nc1cc(Cl)c(C)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2O2/c1-7-9(12)5-8(6-10(7)13)15-11(16)14-3-4-17-2/h5-6H,3-4H2,1-2H3,(H2,14,15,16) |
| InChIKey | VJOHULRYYNSHLZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|