C23H18N2O3S — CID 6059252
3-methoxy-N-[(Z)-(5-phenylsulfanylfuran-2-yl)methylideneamino]naphthalene-2-carboxamide (PubChem CID 6059252) has the molecular formula C23H18N2O3S and a molecular weight of 402.48 g/mol. Its IUPAC name is 3-methoxy-N-[(Z)-(5-phenylsulfanylfuran-2-yl)methylideneamino]naphthalene-2-carboxamide.
| Compound Name | 3-methoxy-N-[(Z)-(5-phenylsulfanylfuran-2-yl)methylideneamino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 6059252 |
| Molecular Formula | C23H18N2O3S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 3-methoxy-N-[(Z)-(5-phenylsulfanylfuran-2-yl)methylideneamino]naphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)N/N=C\c1ccc(Sc2ccccc2)o1 |
| InChI | InChI=1S/C23H18N2O3S/c1-27-21-14-17-8-6-5-7-16(17)13-20(21)23(26)25-24-15-18-11-12-22(28-18)29-19-9-3-2-4-10-19/h2-15H,1H3,(H,25,26)/b24-15- |
| InChIKey | ZPKLQCHWBGZBDN-IWIPYMOSSA-N |
| XLogP | 5.36 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|