C22H25F4N3O2 — CID 60592666
1-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-[1-[3-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 60592666) has the molecular formula C22H25F4N3O2 and a molecular weight of 439.45 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-[1-[3-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-[1-[3-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 60592666 |
| Molecular Formula | C22H25F4N3O2 |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 1-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-3-[1-[3-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | CC(NC(=O)NCC(c1cccc(F)c1)N1CCOCC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H25F4N3O2/c1-15(16-4-2-6-18(12-16)22(24,25)26)28-21(30)27-14-20(29-8-10-31-11-9-29)17-5-3-7-19(23)13-17/h2-7,12-13,15,20H,8-11,14H2,1H3,(H2,27,28,30) |
| InChIKey | OXTAZEYARYFQRH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |