C18H29NO2S — CID 60593252
5-tert-butyl-N-(3-methoxypropyl)-N-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 60593252) has the molecular formula C18H29NO2S and a molecular weight of 323.50 g/mol. Its IUPAC name is 5-tert-butyl-N-(3-methoxypropyl)-N-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | 5-tert-butyl-N-(3-methoxypropyl)-N-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 60593252 |
| Molecular Formula | C18H29NO2S |
| Molecular Weight | 323.50 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 5-tert-butyl-N-(3-methoxypropyl)-N-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | COCCCN(C)C(=O)c1cc2c(s1)CCC(C(C)(C)C)C2 |
| InChI | InChI=1S/C18H29NO2S/c1-18(2,3)14-7-8-15-13(11-14)12-16(22-15)17(20)19(4)9-6-10-21-5/h12,14H,6-11H2,1-5H3 |
| InChIKey | WZPZXJSLWQYQMY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|