About 5-amino-1-(4-amino-1,2,5-oxadiazol-3-yl)triazole-4-carbonitrile
5-amino-1-(4-amino-1,2,5-oxadiazol-3-yl)triazole-4-carbonitrile (PubChem CID 605944) has the molecular formula C5H4N8O
and a molecular weight of 192.14 g/mol. Its IUPAC name is 5-amino-1-(4-amino-1,2,5-oxadiazol-3-yl)triazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-1-(4-amino-1,2,5-oxadiazol-3-yl)triazole-4-carbonitrile |
| PubChem CID | 605944 |
| Molecular Formula | C5H4N8O |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 5-amino-1-(4-amino-1,2,5-oxadiazol-3-yl)triazole-4-carbonitrile |
| SMILES | N#Cc1nnn(-c2nonc2N)c1N |
| InChI | InChI=1S/C5H4N8O/c6-1-2-4(8)13(12-9-2)5-3(7)10-14-11-5/h8H2,(H2,7,10) |
| InChIKey | XDYAVDVYBWDIJD-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 5-amino-1-(4-amino-1,2,5-oxadiazol-3-yl)triazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-(4-amino-1,2,5-oxadiazol-3-yl)triazole-4-carbonitrile?
The IUPAC name of 5-amino-1-(4-amino-1,2,5-oxadiazol-3-yl)triazole-4-carbonitrile (CID 605944) is 5-amino-1-(4-amino-1,2,5-oxadiazol-3-yl)triazole-4-carbonitrile.
What is the SMILES notation for 5-amino-1-(4-amino-1,2,5-oxadiazol-3-yl)triazole-4-carbonitrile?
The canonical SMILES for 5-amino-1-(4-amino-1,2,5-oxadiazol-3-yl)triazole-4-carbonitrile is N#Cc1nnn(-c2nonc2N)c1N.
What is the InChIKey of 5-amino-1-(4-amino-1,2,5-oxadiazol-3-yl)triazole-4-carbonitrile?
The InChIKey is XDYAVDVYBWDIJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N8O/c6-1-2-4(8)13(12-9-2)5-3(7)10-14-11-5/h8H2,(H2,7,10).
What are the key properties of 5-amino-1-(4-amino-1,2,5-oxadiazol-3-yl)triazole-4-carbonitrile?
5-amino-1-(4-amino-1,2,5-oxadiazol-3-yl)triazole-4-carbonitrile has a molecular weight of 192.14 g/mol, XLogP of -1.31, 1 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-(4-amino-1,2,5-oxadiazol-3-yl)triazole-4-carbonitrile is sourced from PubChem (CID 605944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).