About (NZ)-N-(6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine
(NZ)-N-(6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine (PubChem CID 6059475) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is (NZ)-N-(6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-(6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine |
| PubChem CID | 6059475 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (NZ)-N-(6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine |
| SMILES | CCCc1noc2c1/C(=N\O)CC(c1ccccc1)C2 |
| InChI | InChI=1S/C16H18N2O2/c1-2-6-13-16-14(17-19)9-12(10-15(16)20-18-13)11-7-4-3-5-8-11/h3-5,7-8,12,19H,2,6,9-10H2,1H3/b17-14- |
| InChIKey | AXJATIZSPNEBAD-VKAVYKQESA-N |
| XLogP | 3.54 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-(6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-(6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine?
The IUPAC name of (NZ)-N-(6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine (CID 6059475) is (NZ)-N-(6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine.
What is the SMILES notation for (NZ)-N-(6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine?
The canonical SMILES for (NZ)-N-(6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine is CCCc1noc2c1/C(=N\O)CC(c1ccccc1)C2.
What is the InChIKey of (NZ)-N-(6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine?
The InChIKey is AXJATIZSPNEBAD-VKAVYKQESA-N. The full InChI is InChI=1S/C16H18N2O2/c1-2-6-13-16-14(17-19)9-12(10-15(16)20-18-13)11-7-4-3-5-8-11/h3-5,7-8,12,19H,2,6,9-10H2,1H3/b17-14-.
What are the key properties of (NZ)-N-(6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine?
(NZ)-N-(6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine has a molecular weight of 270.33 g/mol, XLogP of 3.54, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-(6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene)hydroxylamine is sourced from PubChem (CID 6059475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).