C25H21N3O3 — CID 60596178
3-(1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl)-N-naphthalen-1-ylbenzamide (PubChem CID 60596178) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is 3-(1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl)-N-naphthalen-1-ylbenzamide.
| Compound Name | 3-(1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl)-N-naphthalen-1-ylbenzamide |
|---|---|
| PubChem CID | 60596178 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 3-(1,4-dioxo-4a,5,8,8a-tetrahydro-3H-phthalazin-2-yl)-N-naphthalen-1-ylbenzamide |
| SMILES | O=C(Nc1cccc2ccccc12)c1cccc(N2NC(=O)C3CC=CCC3C2=O)c1 |
| InChI | InChI=1S/C25H21N3O3/c29-23(26-22-14-6-8-16-7-1-2-11-19(16)22)17-9-5-10-18(15-17)28-25(31)21-13-4-3-12-20(21)24(30)27-28/h1-11,14-15,20-21H,12-13H2,(H,26,29)(H,27,30) |
| InChIKey | LPNDDZRVKQJTSK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|