C24H26N2O4S — CID 60596798
N-(6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 60596798) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-(6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-(6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 60596798 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-(6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(CC(=O)Nc2nc3c(s2)CC(c2ccccc2)CC3)cc(OC)c1OC |
| InChI | InChI=1S/C24H26N2O4S/c1-28-19-11-15(12-20(29-2)23(19)30-3)13-22(27)26-24-25-18-10-9-17(14-21(18)31-24)16-7-5-4-6-8-16/h4-8,11-12,17H,9-10,13-14H2,1-3H3,(H,25,26,27) |
| InChIKey | FYMQRQCVTGMTHW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |