About (7-methoxynaphthalen-2-yl) 2,3-dihydro-1,4-benzodioxine-5-carboxylate
(7-methoxynaphthalen-2-yl) 2,3-dihydro-1,4-benzodioxine-5-carboxylate (PubChem CID 60596820) has the molecular formula C20H16O5
and a molecular weight of 336.34 g/mol. Its IUPAC name is (7-methoxynaphthalen-2-yl) 2,3-dihydro-1,4-benzodioxine-5-carboxylate.
Molecular Properties
| Compound Name | (7-methoxynaphthalen-2-yl) 2,3-dihydro-1,4-benzodioxine-5-carboxylate |
| PubChem CID | 60596820 |
| Molecular Formula | C20H16O5 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | (7-methoxynaphthalen-2-yl) 2,3-dihydro-1,4-benzodioxine-5-carboxylate |
| SMILES | COc1ccc2ccc(OC(=O)c3cccc4c3OCCO4)cc2c1 |
| InChI | InChI=1S/C20H16O5/c1-22-15-7-5-13-6-8-16(12-14(13)11-15)25-20(21)17-3-2-4-18-19(17)24-10-9-23-18/h2-8,11-12H,9-10H2,1H3 |
| InChIKey | TZANRRDFSQFULK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (7-methoxynaphthalen-2-yl) 2,3-dihydro-1,4-benzodioxine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methoxynaphthalen-2-yl) 2,3-dihydro-1,4-benzodioxine-5-carboxylate?
The IUPAC name of (7-methoxynaphthalen-2-yl) 2,3-dihydro-1,4-benzodioxine-5-carboxylate (CID 60596820) is (7-methoxynaphthalen-2-yl) 2,3-dihydro-1,4-benzodioxine-5-carboxylate.
What is the SMILES notation for (7-methoxynaphthalen-2-yl) 2,3-dihydro-1,4-benzodioxine-5-carboxylate?
The canonical SMILES for (7-methoxynaphthalen-2-yl) 2,3-dihydro-1,4-benzodioxine-5-carboxylate is COc1ccc2ccc(OC(=O)c3cccc4c3OCCO4)cc2c1.
What is the InChIKey of (7-methoxynaphthalen-2-yl) 2,3-dihydro-1,4-benzodioxine-5-carboxylate?
The InChIKey is TZANRRDFSQFULK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16O5/c1-22-15-7-5-13-6-8-16(12-14(13)11-15)25-20(21)17-3-2-4-18-19(17)24-10-9-23-18/h2-8,11-12H,9-10H2,1H3.
What are the key properties of (7-methoxynaphthalen-2-yl) 2,3-dihydro-1,4-benzodioxine-5-carboxylate?
(7-methoxynaphthalen-2-yl) 2,3-dihydro-1,4-benzodioxine-5-carboxylate has a molecular weight of 336.34 g/mol, XLogP of 3.84, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methoxynaphthalen-2-yl) 2,3-dihydro-1,4-benzodioxine-5-carboxylate is sourced from PubChem (CID 60596820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).