C17H18Cl2N2O2 — CID 60596925
N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]pentanamide (PubChem CID 60596925) has the molecular formula C17H18Cl2N2O2 and a molecular weight of 353.25 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]pentanamide.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]pentanamide |
|---|---|
| PubChem CID | 60596925 |
| Molecular Formula | C17H18Cl2N2O2 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]-6-oxo-3-pyridinyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(=O)n(Cc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C17H18Cl2N2O2/c1-2-3-4-16(22)20-13-6-8-17(23)21(11-13)10-12-5-7-14(18)15(19)9-12/h5-9,11H,2-4,10H2,1H3,(H,20,22) |
| InChIKey | MQIBDPPPZSCUNK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |