About 3-acetamidopropyl 4-chloro-2-methoxybenzoate
3-acetamidopropyl 4-chloro-2-methoxybenzoate (PubChem CID 60598323) has the molecular formula C13H16ClNO4
and a molecular weight of 285.73 g/mol. Its IUPAC name is 3-acetamidopropyl 4-chloro-2-methoxybenzoate.
Molecular Properties
| Compound Name | 3-acetamidopropyl 4-chloro-2-methoxybenzoate |
| PubChem CID | 60598323 |
| Molecular Formula | C13H16ClNO4 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 3-acetamidopropyl 4-chloro-2-methoxybenzoate |
| SMILES | COc1cc(Cl)ccc1C(=O)OCCCNC(C)=O |
| InChI | InChI=1S/C13H16ClNO4/c1-9(16)15-6-3-7-19-13(17)11-5-4-10(14)8-12(11)18-2/h4-5,8H,3,6-7H2,1-2H3,(H,15,16) |
| InChIKey | UXKUMNXCUXAQCX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-acetamidopropyl 4-chloro-2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetamidopropyl 4-chloro-2-methoxybenzoate?
The IUPAC name of 3-acetamidopropyl 4-chloro-2-methoxybenzoate (CID 60598323) is 3-acetamidopropyl 4-chloro-2-methoxybenzoate.
What is the SMILES notation for 3-acetamidopropyl 4-chloro-2-methoxybenzoate?
The canonical SMILES for 3-acetamidopropyl 4-chloro-2-methoxybenzoate is COc1cc(Cl)ccc1C(=O)OCCCNC(C)=O.
What is the InChIKey of 3-acetamidopropyl 4-chloro-2-methoxybenzoate?
The InChIKey is UXKUMNXCUXAQCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClNO4/c1-9(16)15-6-3-7-19-13(17)11-5-4-10(14)8-12(11)18-2/h4-5,8H,3,6-7H2,1-2H3,(H,15,16).
What are the key properties of 3-acetamidopropyl 4-chloro-2-methoxybenzoate?
3-acetamidopropyl 4-chloro-2-methoxybenzoate has a molecular weight of 285.73 g/mol, XLogP of 2.03, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetamidopropyl 4-chloro-2-methoxybenzoate is sourced from PubChem (CID 60598323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).