C20H31F3N6O2 — CID 60599022
1-(4-pyrimidin-2-ylpiperazin-1-yl)-2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]propan-1-one (PubChem CID 60599022) has the molecular formula C20H31F3N6O2 and a molecular weight of 444.50 g/mol. Its IUPAC name is 1-(4-pyrimidin-2-ylpiperazin-1-yl)-2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-(4-pyrimidin-2-ylpiperazin-1-yl)-2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 60599022 |
| Molecular Formula | C20H31F3N6O2 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 1-(4-pyrimidin-2-ylpiperazin-1-yl)-2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]propan-1-one |
| SMILES | CC(C(=O)N1CCN(c2ncccn2)CC1)N1CCN(CCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C20H31F3N6O2/c1-17(18(30)28-11-13-29(14-12-28)19-24-4-2-5-25-19)27-9-7-26(8-10-27)6-3-15-31-16-20(21,22)23/h2,4-5,17H,3,6-16H2,1H3 |
| InChIKey | OYJHYFHCMFZKPH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 65.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|