C21H25ClN2O4 — CID 60599259
ethyl 3-[3-(5-chloro-2-methoxyanilino)propanoylamino]-3-phenylpropanoate (PubChem CID 60599259) has the molecular formula C21H25ClN2O4 and a molecular weight of 404.89 g/mol. Its IUPAC name is ethyl 3-[3-(5-chloro-2-methoxyanilino)propanoylamino]-3-phenylpropanoate.
| Compound Name | ethyl 3-[3-(5-chloro-2-methoxyanilino)propanoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 60599259 |
| Molecular Formula | C21H25ClN2O4 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | ethyl 3-[3-(5-chloro-2-methoxyanilino)propanoylamino]-3-phenylpropanoate |
| SMILES | CCOC(=O)CC(NC(=O)CCNc1cc(Cl)ccc1OC)c1ccccc1 |
| InChI | InChI=1S/C21H25ClN2O4/c1-3-28-21(26)14-17(15-7-5-4-6-8-15)24-20(25)11-12-23-18-13-16(22)9-10-19(18)27-2/h4-10,13,17,23H,3,11-12,14H2,1-2H3,(H,24,25) |
| InChIKey | FUDWQCDJSPYOEW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |