About 2-amino-6-chloro-4-methylpyridine-3,5-dicarbonitrile
2-amino-6-chloro-4-methylpyridine-3,5-dicarbonitrile (PubChem CID 606000) has the molecular formula C8H5ClN4
and a molecular weight of 192.61 g/mol. Its IUPAC name is 2-amino-6-chloro-4-methylpyridine-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-amino-6-chloro-4-methylpyridine-3,5-dicarbonitrile |
| PubChem CID | 606000 |
| Molecular Formula | C8H5ClN4 |
| Molecular Weight | 192.61 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 2-amino-6-chloro-4-methylpyridine-3,5-dicarbonitrile |
| SMILES | Cc1c(C#N)c(N)nc(Cl)c1C#N |
| InChI | InChI=1S/C8H5ClN4/c1-4-5(2-10)7(9)13-8(12)6(4)3-11/h1H3,(H2,12,13) |
| InChIKey | KXEZBQTZEBDTNH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.61 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-chloro-4-methylpyridine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-chloro-4-methylpyridine-3,5-dicarbonitrile?
The IUPAC name of 2-amino-6-chloro-4-methylpyridine-3,5-dicarbonitrile (CID 606000) is 2-amino-6-chloro-4-methylpyridine-3,5-dicarbonitrile.
What is the SMILES notation for 2-amino-6-chloro-4-methylpyridine-3,5-dicarbonitrile?
The canonical SMILES for 2-amino-6-chloro-4-methylpyridine-3,5-dicarbonitrile is Cc1c(C#N)c(N)nc(Cl)c1C#N.
What is the InChIKey of 2-amino-6-chloro-4-methylpyridine-3,5-dicarbonitrile?
The InChIKey is KXEZBQTZEBDTNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN4/c1-4-5(2-10)7(9)13-8(12)6(4)3-11/h1H3,(H2,12,13).
What are the key properties of 2-amino-6-chloro-4-methylpyridine-3,5-dicarbonitrile?
2-amino-6-chloro-4-methylpyridine-3,5-dicarbonitrile has a molecular weight of 192.61 g/mol, XLogP of 1.37, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-chloro-4-methylpyridine-3,5-dicarbonitrile is sourced from PubChem (CID 606000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).