About 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate
1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate (PubChem CID 606010) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate.
Analyze 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate?
The IUPAC name of 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate (CID 606010) is 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate.
What is the SMILES notation for 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate?
The canonical SMILES for 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate is CCC(CC1=C(C)C(=O)CCC1(C)C)OC(C)=O.
What is the InChIKey of 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate?
The InChIKey is HPAMAFSQIHSUDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-6-12(18-11(3)16)9-13-10(2)14(17)7-8-15(13,4)5/h12H,6-9H2,1-5H3.
What are the key properties of 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate?
1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate has a molecular weight of 252.35 g/mol, XLogP of 3.42, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)butan-2-yl acetate is sourced from PubChem (CID 606010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).