About 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(2-phenylethyl)acetamide
2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(2-phenylethyl)acetamide (PubChem CID 606016) has the molecular formula C16H16N4OS
and a molecular weight of 312.40 g/mol. Its IUPAC name is 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(2-phenylethyl)acetamide.
Molecular Properties
| Compound Name | 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(2-phenylethyl)acetamide |
| PubChem CID | 606016 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(2-phenylethyl)acetamide |
| SMILES | O=C(CSc1nc2ncccc2[nH]1)NCCc1ccccc1 |
| InChI | InChI=1S/C16H16N4OS/c21-14(17-10-8-12-5-2-1-3-6-12)11-22-16-19-13-7-4-9-18-15(13)20-16/h1-7,9H,8,10-11H2,(H,17,21)(H,18,19,20) |
| InChIKey | IFHAUPSQDLXLPH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(2-phenylethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(2-phenylethyl)acetamide?
The IUPAC name of 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(2-phenylethyl)acetamide (CID 606016) is 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(2-phenylethyl)acetamide.
What is the SMILES notation for 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(2-phenylethyl)acetamide?
The canonical SMILES for 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(2-phenylethyl)acetamide is O=C(CSc1nc2ncccc2[nH]1)NCCc1ccccc1.
What is the InChIKey of 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(2-phenylethyl)acetamide?
The InChIKey is IFHAUPSQDLXLPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4OS/c21-14(17-10-8-12-5-2-1-3-6-12)11-22-16-19-13-7-4-9-18-15(13)20-16/h1-7,9H,8,10-11H2,(H,17,21)(H,18,19,20).
What are the key properties of 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(2-phenylethyl)acetamide?
2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(2-phenylethyl)acetamide has a molecular weight of 312.40 g/mol, XLogP of 2.41, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-imidazo[4,5-b]pyridin-2-ylsulfanyl)-N-(2-phenylethyl)acetamide is sourced from PubChem (CID 606016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).