C21H25FN2O4 — CID 60601900
1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-ethyl-3-[3-(4-fluorophenoxy)propyl]urea (PubChem CID 60601900) has the molecular formula C21H25FN2O4 and a molecular weight of 388.44 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-ethyl-3-[3-(4-fluorophenoxy)propyl]urea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-ethyl-3-[3-(4-fluorophenoxy)propyl]urea |
|---|---|
| PubChem CID | 60601900 |
| Molecular Formula | C21H25FN2O4 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1-ethyl-3-[3-(4-fluorophenoxy)propyl]urea |
| SMILES | CCN(CC1COc2ccccc2O1)C(=O)NCCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C21H25FN2O4/c1-2-24(14-18-15-27-19-6-3-4-7-20(19)28-18)21(25)23-12-5-13-26-17-10-8-16(22)9-11-17/h3-4,6-11,18H,2,5,12-15H2,1H3,(H,23,25) |
| InChIKey | WQXHNOSPIXUWMX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|