C16H15N7O2S — CID 60602055
2-[[3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-5-(1,2,4-triazol-1-ylmethyl)-1,3,4-oxadiazole (PubChem CID 60602055) has the molecular formula C16H15N7O2S and a molecular weight of 369.41 g/mol. Its IUPAC name is 2-[[3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-5-(1,2,4-triazol-1-ylmethyl)-1,3,4-oxadiazole.
| Compound Name | 2-[[3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-5-(1,2,4-triazol-1-ylmethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 60602055 |
| Molecular Formula | C16H15N7O2S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-[[3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-5-(1,2,4-triazol-1-ylmethyl)-1,3,4-oxadiazole |
| SMILES | CCc1ccc(-c2noc(CSc3nnc(Cn4cncn4)o3)n2)cc1 |
| InChI | InChI=1S/C16H15N7O2S/c1-2-11-3-5-12(6-4-11)15-19-14(25-22-15)8-26-16-21-20-13(24-16)7-23-10-17-9-18-23/h3-6,9-10H,2,7-8H2,1H3 |
| InChIKey | YLSPJBMICOMKMN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 108.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |