C17H11F6N3 — CID 606021
1-(1,1,2,3,3,3-hexafluoropropyl)-4,5-diphenyltriazole (PubChem CID 606021) has the molecular formula C17H11F6N3 and a molecular weight of 371.28 g/mol. Its IUPAC name is 1-(1,1,2,3,3,3-hexafluoropropyl)-4,5-diphenyltriazole.
| Compound Name | 1-(1,1,2,3,3,3-hexafluoropropyl)-4,5-diphenyltriazole |
|---|---|
| PubChem CID | 606021 |
| Molecular Formula | C17H11F6N3 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 1-(1,1,2,3,3,3-hexafluoropropyl)-4,5-diphenyltriazole |
| SMILES | FC(C(F)(F)F)C(F)(F)n1nnc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C17H11F6N3/c18-15(16(19,20)21)17(22,23)26-14(12-9-5-2-6-10-12)13(24-25-26)11-7-3-1-4-8-11/h1-10,15H |
| InChIKey | DRZGOYYHCXIHCZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |