About (7E)-7-[(3-fluorophenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one
(7E)-7-[(3-fluorophenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one (PubChem CID 60602379) has the molecular formula C17H11FO4
and a molecular weight of 298.27 g/mol. Its IUPAC name is (7E)-7-[(3-fluorophenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one.
Molecular Properties
| Compound Name | (7E)-7-[(3-fluorophenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one |
| PubChem CID | 60602379 |
| Molecular Formula | C17H11FO4 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | (7E)-7-[(3-fluorophenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one |
| SMILES | O=C1/C(=C/c2cccc(F)c2)COc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C17H11FO4/c18-12-3-1-2-10(5-12)4-11-8-20-14-7-16-15(21-9-22-16)6-13(14)17(11)19/h1-7H,8-9H2/b11-4+ |
| InChIKey | LOCDGXHULOZGDA-NYYWCZLTSA-N |
| XLogP | 3.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (7E)-7-[(3-fluorophenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7E)-7-[(3-fluorophenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one?
The IUPAC name of (7E)-7-[(3-fluorophenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one (CID 60602379) is (7E)-7-[(3-fluorophenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one.
What is the SMILES notation for (7E)-7-[(3-fluorophenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one?
The canonical SMILES for (7E)-7-[(3-fluorophenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one is O=C1/C(=C/c2cccc(F)c2)COc2cc3c(cc21)OCO3.
What is the InChIKey of (7E)-7-[(3-fluorophenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one?
The InChIKey is LOCDGXHULOZGDA-NYYWCZLTSA-N. The full InChI is InChI=1S/C17H11FO4/c18-12-3-1-2-10(5-12)4-11-8-20-14-7-16-15(21-9-22-16)6-13(14)17(11)19/h1-7H,8-9H2/b11-4+.
What are the key properties of (7E)-7-[(3-fluorophenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one?
(7E)-7-[(3-fluorophenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one has a molecular weight of 298.27 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7E)-7-[(3-fluorophenyl)methylidene]-[1,3]dioxolo[4,5-g]chromen-8-one is sourced from PubChem (CID 60602379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).