C20H25N3O — CID 60602901
(E)-3-(4-piperidin-1-ylphenyl)-1-(1-propan-2-ylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 60602901) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (E)-3-(4-piperidin-1-ylphenyl)-1-(1-propan-2-ylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-piperidin-1-ylphenyl)-1-(1-propan-2-ylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 60602901 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (E)-3-(4-piperidin-1-ylphenyl)-1-(1-propan-2-ylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | CC(C)n1cc(C(=O)/C=C/c2ccc(N3CCCCC3)cc2)cn1 |
| InChI | InChI=1S/C20H25N3O/c1-16(2)23-15-18(14-21-23)20(24)11-8-17-6-9-19(10-7-17)22-12-4-3-5-13-22/h6-11,14-16H,3-5,12-13H2,1-2H3/b11-8+ |
| InChIKey | AMCSXUMZVHSBKS-DHZHZOJOSA-N |
| XLogP | 4.35 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|