C20H24Cl2N2O4S — CID 60603932
N-[1-(3,4-dichlorophenyl)butyl]-3-(dimethylsulfamoyl)-4-methoxybenzamide (PubChem CID 60603932) has the molecular formula C20H24Cl2N2O4S and a molecular weight of 459.40 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)butyl]-3-(dimethylsulfamoyl)-4-methoxybenzamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)butyl]-3-(dimethylsulfamoyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 60603932 |
| Molecular Formula | C20H24Cl2N2O4S |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)butyl]-3-(dimethylsulfamoyl)-4-methoxybenzamide |
| SMILES | CCCC(NC(=O)c1ccc(OC)c(S(=O)(=O)N(C)C)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H24Cl2N2O4S/c1-5-6-17(13-7-9-15(21)16(22)11-13)23-20(25)14-8-10-18(28-4)19(12-14)29(26,27)24(2)3/h7-12,17H,5-6H2,1-4H3,(H,23,25) |
| InChIKey | VABZTOREZHZPGN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |