C22H21FN2O4 — CID 60604199
6-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[3-(4-fluorophenoxy)propyl]pyridazin-3-one (PubChem CID 60604199) has the molecular formula C22H21FN2O4 and a molecular weight of 396.42 g/mol. Its IUPAC name is 6-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[3-(4-fluorophenoxy)propyl]pyridazin-3-one.
| Compound Name | 6-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[3-(4-fluorophenoxy)propyl]pyridazin-3-one |
|---|---|
| PubChem CID | 60604199 |
| Molecular Formula | C22H21FN2O4 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 6-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[3-(4-fluorophenoxy)propyl]pyridazin-3-one |
| SMILES | O=c1ccc(-c2ccc3c(c2)OCCCO3)nn1CCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C22H21FN2O4/c23-17-4-6-18(7-5-17)27-12-1-11-25-22(26)10-8-19(24-25)16-3-9-20-21(15-16)29-14-2-13-28-20/h3-10,15H,1-2,11-14H2 |
| InChIKey | YMVDQOLLRMVHAM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|