C16H21ClN4OS — CID 60604484
4-(3-chlorophenyl)-3-(2-ethoxyethylsulfanyl)-5-pyrrolidin-1-yl-1,2,4-triazole (PubChem CID 60604484) has the molecular formula C16H21ClN4OS and a molecular weight of 352.89 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-3-(2-ethoxyethylsulfanyl)-5-pyrrolidin-1-yl-1,2,4-triazole.
| Compound Name | 4-(3-chlorophenyl)-3-(2-ethoxyethylsulfanyl)-5-pyrrolidin-1-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 60604484 |
| Molecular Formula | C16H21ClN4OS |
| Molecular Weight | 352.89 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 4-(3-chlorophenyl)-3-(2-ethoxyethylsulfanyl)-5-pyrrolidin-1-yl-1,2,4-triazole |
| SMILES | CCOCCSc1nnc(N2CCCC2)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H21ClN4OS/c1-2-22-10-11-23-16-19-18-15(20-8-3-4-9-20)21(16)14-7-5-6-13(17)12-14/h5-7,12H,2-4,8-11H2,1H3 |
| InChIKey | RENPTMGKLFZKAA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.89 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|