C14H19N3 — CID 6060513
N-[(Z)-1-phenylethylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 6060513) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is N-[(Z)-1-phenylethylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | N-[(Z)-1-phenylethylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 6060513 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | N-[(Z)-1-phenylethylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | C/C(=N/NC1=NCCCCC1)c1ccccc1 |
| InChI | InChI=1S/C14H19N3/c1-12(13-8-4-2-5-9-13)16-17-14-10-6-3-7-11-15-14/h2,4-5,8-9H,3,6-7,10-11H2,1H3,(H,15,17)/b16-12- |
| InChIKey | VROKIYNHZIGYPW-VBKFSLOCSA-N |
| XLogP | 2.97 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|