C15H10ClN3O5 — CID 6060588
(E)-3-(3-chlorophenyl)-N-(2,4-dinitrophenyl)prop-2-enamide (PubChem CID 6060588) has the molecular formula C15H10ClN3O5 and a molecular weight of 347.71 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-N-(2,4-dinitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chlorophenyl)-N-(2,4-dinitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6060588 |
| Molecular Formula | C15H10ClN3O5 |
| Molecular Weight | 347.71 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-N-(2,4-dinitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H10ClN3O5/c16-11-3-1-2-10(8-11)4-7-15(20)17-13-6-5-12(18(21)22)9-14(13)19(23)24/h1-9H,(H,17,20)/b7-4+ |
| InChIKey | PHNKUAQJNFYDKX-QPJJXVBHSA-N |
| XLogP | 3.81 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.71 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|