C10H17N3O2 — CID 60606531
N-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]pentanamide (PubChem CID 60606531) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is N-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]pentanamide.
| Compound Name | N-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 60606531 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | N-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]pentanamide |
| SMILES | CCCCC(=O)NC(C)c1nc(C)no1 |
| InChI | InChI=1S/C10H17N3O2/c1-4-5-6-9(14)11-7(2)10-12-8(3)13-15-10/h7H,4-6H2,1-3H3,(H,11,14) |
| InChIKey | SSMOLWODIKBYRS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |