About ethyl 1-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]piperidine-4-carboxylate
ethyl 1-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]piperidine-4-carboxylate (PubChem CID 60606634) has the molecular formula C16H27F2N3O3
and a molecular weight of 347.41 g/mol. Its IUPAC name is ethyl 1-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]piperidine-4-carboxylate |
| PubChem CID | 60606634 |
| Molecular Formula | C16H27F2N3O3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | ethyl 1-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)NC2CCN(CC(F)F)CC2)CC1 |
| InChI | InChI=1S/C16H27F2N3O3/c1-2-24-15(22)12-3-9-21(10-4-12)16(23)19-13-5-7-20(8-6-13)11-14(17)18/h12-14H,2-11H2,1H3,(H,19,23) |
| InChIKey | NKIKWFNLFBOMNR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]piperidine-4-carboxylate?
The IUPAC name of ethyl 1-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]piperidine-4-carboxylate (CID 60606634) is ethyl 1-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]piperidine-4-carboxylate is CCOC(=O)C1CCN(C(=O)NC2CCN(CC(F)F)CC2)CC1.
What is the InChIKey of ethyl 1-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]piperidine-4-carboxylate?
The InChIKey is NKIKWFNLFBOMNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27F2N3O3/c1-2-24-15(22)12-3-9-21(10-4-12)16(23)19-13-5-7-20(8-6-13)11-14(17)18/h12-14H,2-11H2,1H3,(H,19,23).
What are the key properties of ethyl 1-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]piperidine-4-carboxylate?
ethyl 1-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]piperidine-4-carboxylate has a molecular weight of 347.41 g/mol, XLogP of 1.70, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[[1-(2,2-difluoroethyl)piperidin-4-yl]carbamoyl]piperidine-4-carboxylate is sourced from PubChem (CID 60606634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).