C14H16F3N3S — CID 60607039
4-(2,2,2-trifluoroethyl)-3-[(2,4,6-trimethylphenyl)methylsulfanyl]-1,2,4-triazole (PubChem CID 60607039) has the molecular formula C14H16F3N3S and a molecular weight of 315.36 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethyl)-3-[(2,4,6-trimethylphenyl)methylsulfanyl]-1,2,4-triazole.
| Compound Name | 4-(2,2,2-trifluoroethyl)-3-[(2,4,6-trimethylphenyl)methylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 60607039 |
| Molecular Formula | C14H16F3N3S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 4-(2,2,2-trifluoroethyl)-3-[(2,4,6-trimethylphenyl)methylsulfanyl]-1,2,4-triazole |
| SMILES | Cc1cc(C)c(CSc2nncn2CC(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C14H16F3N3S/c1-9-4-10(2)12(11(3)5-9)6-21-13-19-18-8-20(13)7-14(15,16)17/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | DJTNQAATWZGMPG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |