C26H30N2O3 — CID 60607197
1-[2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetyl]-N-phenylpiperidine-4-carboxamide (PubChem CID 60607197) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 1-[2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetyl]-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-[2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetyl]-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 60607197 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 1-[2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetyl]-N-phenylpiperidine-4-carboxamide |
| SMILES | Cc1cc2occ(CC(=O)N3CCC(C(=O)Nc4ccccc4)CC3)c2cc1C(C)C |
| InChI | InChI=1S/C26H30N2O3/c1-17(2)22-15-23-20(16-31-24(23)13-18(22)3)14-25(29)28-11-9-19(10-12-28)26(30)27-21-7-5-4-6-8-21/h4-8,13,15-17,19H,9-12,14H2,1-3H3,(H,27,30) |
| InChIKey | KUFKHXQOABOJEI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |