C25H23N3O2S — CID 60607360
(E)-N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-(9-ethylcarbazol-3-yl)prop-2-enamide (PubChem CID 60607360) has the molecular formula C25H23N3O2S and a molecular weight of 429.55 g/mol. Its IUPAC name is (E)-N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-(9-ethylcarbazol-3-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-(9-ethylcarbazol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 60607360 |
| Molecular Formula | C25H23N3O2S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | (E)-N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-(9-ethylcarbazol-3-yl)prop-2-enamide |
| SMILES | CCn1c2ccccc2c2cc(/C=C/C(=O)Nc3ccccc3SCC(N)=O)ccc21 |
| InChI | InChI=1S/C25H23N3O2S/c1-2-28-21-9-5-3-7-18(21)19-15-17(11-13-22(19)28)12-14-25(30)27-20-8-4-6-10-23(20)31-16-24(26)29/h3-15H,2,16H2,1H3,(H2,26,29)(H,27,30)/b14-12+ |
| InChIKey | JDTFASOLKGCABJ-WYMLVPIESA-N |
| XLogP | 5.04 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|