C24H28N4O3S — CID 60607838
N,N-diethyl-3-[[2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]amino]benzamide (PubChem CID 60607838) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is N,N-diethyl-3-[[2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]amino]benzamide.
| Compound Name | N,N-diethyl-3-[[2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 60607838 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | N,N-diethyl-3-[[2-(7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)Cn2cnc3sc4c(c3c2=O)CCC(C)C4)c1 |
| InChI | InChI=1S/C24H28N4O3S/c1-4-27(5-2)23(30)16-7-6-8-17(12-16)26-20(29)13-28-14-25-22-21(24(28)31)18-10-9-15(3)11-19(18)32-22/h6-8,12,14-15H,4-5,9-11,13H2,1-3H3,(H,26,29) |
| InChIKey | LIFPZIZXURTNIO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |