C13H15F2N3O — CID 60608504
N-(2,2-difluoroethyl)-N-propyl-1H-indazole-3-carboxamide (PubChem CID 60608504) has the molecular formula C13H15F2N3O and a molecular weight of 267.28 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-propyl-1H-indazole-3-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-N-propyl-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 60608504 |
| Molecular Formula | C13H15F2N3O |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-propyl-1H-indazole-3-carboxamide |
| SMILES | CCCN(CC(F)F)C(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C13H15F2N3O/c1-2-7-18(8-11(14)15)13(19)12-9-5-3-4-6-10(9)16-17-12/h3-6,11H,2,7-8H2,1H3,(H,16,17) |
| InChIKey | PYFDFYOPJTYGKC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |