C18H27NO3S — CID 60608736
2-cyclohexylsulfanyl-N-[1-(2,5-dimethoxyphenyl)ethyl]acetamide (PubChem CID 60608736) has the molecular formula C18H27NO3S and a molecular weight of 337.49 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-N-[1-(2,5-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-cyclohexylsulfanyl-N-[1-(2,5-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 60608736 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-cyclohexylsulfanyl-N-[1-(2,5-dimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(OC)c(C(C)NC(=O)CSC2CCCCC2)c1 |
| InChI | InChI=1S/C18H27NO3S/c1-13(16-11-14(21-2)9-10-17(16)22-3)19-18(20)12-23-15-7-5-4-6-8-15/h9-11,13,15H,4-8,12H2,1-3H3,(H,19,20) |
| InChIKey | VWAUFBKYVSILAN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |