C12H12F6N6S2 — CID 60608788
4-(2,2,2-trifluoroethyl)-3-[(E)-4-[[4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]sulfanyl]but-2-enyl]sulfanyl-1,2,4-triazole (PubChem CID 60608788) has the molecular formula C12H12F6N6S2 and a molecular weight of 418.39 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethyl)-3-[(E)-4-[[4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]sulfanyl]but-2-enyl]sulfanyl-1,2,4-triazole.
| Compound Name | 4-(2,2,2-trifluoroethyl)-3-[(E)-4-[[4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]sulfanyl]but-2-enyl]sulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 60608788 |
| Molecular Formula | C12H12F6N6S2 |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 4-(2,2,2-trifluoroethyl)-3-[(E)-4-[[4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]sulfanyl]but-2-enyl]sulfanyl-1,2,4-triazole |
| SMILES | FC(F)(F)Cn1cnnc1SC/C=C/CSc1nncn1CC(F)(F)F |
| InChI | InChI=1S/C12H12F6N6S2/c13-11(14,15)5-23-7-19-21-9(23)25-3-1-2-4-26-10-22-20-8-24(10)6-12(16,17)18/h1-2,7-8H,3-6H2/b2-1+ |
| InChIKey | DGGTZJWCSMNBQG-OWOJBTEDSA-N |
| XLogP | 3.43 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|