C17H18BrNO2 — CID 606093
1-(4-bromophenyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 606093) has the molecular formula C17H18BrNO2 and a molecular weight of 348.24 g/mol. Its IUPAC name is 1-(4-bromophenyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 1-(4-bromophenyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 606093 |
| Molecular Formula | C17H18BrNO2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 1-(4-bromophenyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1cc2c(cc1OC)C(c1ccc(Br)cc1)NCC2 |
| InChI | InChI=1S/C17H18BrNO2/c1-20-15-9-12-7-8-19-17(14(12)10-16(15)21-2)11-3-5-13(18)6-4-11/h3-6,9-10,17,19H,7-8H2,1-2H3 |
| InChIKey | AFGIYTBFSNPSMM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |