About methyl 4-[4-[[2-(3-bromophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-yl]benzoate
methyl 4-[4-[[2-(3-bromophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-yl]benzoate (PubChem CID 60609675) has the molecular formula C22H21BrN2O3S
and a molecular weight of 473.39 g/mol. Its IUPAC name is methyl 4-[4-[[2-(3-bromophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[4-[[2-(3-bromophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-yl]benzoate |
| PubChem CID | 60609675 |
| Molecular Formula | C22H21BrN2O3S |
| Molecular Weight | 473.39 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | methyl 4-[4-[[2-(3-bromophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2nc(CN3CCOC(c4cccc(Br)c4)C3)cs2)cc1 |
| InChI | InChI=1S/C22H21BrN2O3S/c1-27-22(26)16-7-5-15(6-8-16)21-24-19(14-29-21)12-25-9-10-28-20(13-25)17-3-2-4-18(23)11-17/h2-8,11,14,20H,9-10,12-13H2,1H3 |
| InChIKey | XPNZYFMKDJHJIV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[4-[[2-(3-bromophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[4-[[2-(3-bromophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-yl]benzoate?
The IUPAC name of methyl 4-[4-[[2-(3-bromophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-yl]benzoate (CID 60609675) is methyl 4-[4-[[2-(3-bromophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-yl]benzoate.
What is the SMILES notation for methyl 4-[4-[[2-(3-bromophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-yl]benzoate?
The canonical SMILES for methyl 4-[4-[[2-(3-bromophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-yl]benzoate is COC(=O)c1ccc(-c2nc(CN3CCOC(c4cccc(Br)c4)C3)cs2)cc1.
What is the InChIKey of methyl 4-[4-[[2-(3-bromophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-yl]benzoate?
The InChIKey is XPNZYFMKDJHJIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21BrN2O3S/c1-27-22(26)16-7-5-15(6-8-16)21-24-19(14-29-21)12-25-9-10-28-20(13-25)17-3-2-4-18(23)11-17/h2-8,11,14,20H,9-10,12-13H2,1H3.
What are the key properties of methyl 4-[4-[[2-(3-bromophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-yl]benzoate?
methyl 4-[4-[[2-(3-bromophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-yl]benzoate has a molecular weight of 473.39 g/mol, XLogP of 4.93, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[4-[[2-(3-bromophenyl)morpholin-4-yl]methyl]-1,3-thiazol-2-yl]benzoate is sourced from PubChem (CID 60609675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).