About N-[(3,4-dichlorophenyl)methyl]-4-oxo-N-(pyridin-2-ylmethyl)-3H-phthalazine-1-carboxamide
N-[(3,4-dichlorophenyl)methyl]-4-oxo-N-(pyridin-2-ylmethyl)-3H-phthalazine-1-carboxamide (PubChem CID 60610103) has the molecular formula C22H16Cl2N4O2
and a molecular weight of 439.30 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-4-oxo-N-(pyridin-2-ylmethyl)-3H-phthalazine-1-carboxamide.
Molecular Properties
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-4-oxo-N-(pyridin-2-ylmethyl)-3H-phthalazine-1-carboxamide |
| PubChem CID | 60610103 |
| Molecular Formula | C22H16Cl2N4O2 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-4-oxo-N-(pyridin-2-ylmethyl)-3H-phthalazine-1-carboxamide |
| SMILES | O=C(c1n[nH]c(=O)c2ccccc12)N(Cc1ccc(Cl)c(Cl)c1)Cc1ccccn1 |
| InChI | InChI=1S/C22H16Cl2N4O2/c23-18-9-8-14(11-19(18)24)12-28(13-15-5-3-4-10-25-15)22(30)20-16-6-1-2-7-17(16)21(29)27-26-20/h1-11H,12-13H2,(H,27,29) |
| InChIKey | WWZKDTUCXPWRIU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3,4-dichlorophenyl)methyl]-4-oxo-N-(pyridin-2-ylmethyl)-3H-phthalazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dichlorophenyl)methyl]-4-oxo-N-(pyridin-2-ylmethyl)-3H-phthalazine-1-carboxamide?
The IUPAC name of N-[(3,4-dichlorophenyl)methyl]-4-oxo-N-(pyridin-2-ylmethyl)-3H-phthalazine-1-carboxamide (CID 60610103) is N-[(3,4-dichlorophenyl)methyl]-4-oxo-N-(pyridin-2-ylmethyl)-3H-phthalazine-1-carboxamide.
What is the SMILES notation for N-[(3,4-dichlorophenyl)methyl]-4-oxo-N-(pyridin-2-ylmethyl)-3H-phthalazine-1-carboxamide?
The canonical SMILES for N-[(3,4-dichlorophenyl)methyl]-4-oxo-N-(pyridin-2-ylmethyl)-3H-phthalazine-1-carboxamide is O=C(c1n[nH]c(=O)c2ccccc12)N(Cc1ccc(Cl)c(Cl)c1)Cc1ccccn1.
What is the InChIKey of N-[(3,4-dichlorophenyl)methyl]-4-oxo-N-(pyridin-2-ylmethyl)-3H-phthalazine-1-carboxamide?
The InChIKey is WWZKDTUCXPWRIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16Cl2N4O2/c23-18-9-8-14(11-19(18)24)12-28(13-15-5-3-4-10-25-15)22(30)20-16-6-1-2-7-17(16)21(29)27-26-20/h1-11H,12-13H2,(H,27,29).
What are the key properties of N-[(3,4-dichlorophenyl)methyl]-4-oxo-N-(pyridin-2-ylmethyl)-3H-phthalazine-1-carboxamide?
N-[(3,4-dichlorophenyl)methyl]-4-oxo-N-(pyridin-2-ylmethyl)-3H-phthalazine-1-carboxamide has a molecular weight of 439.30 g/mol, XLogP of 4.47, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dichlorophenyl)methyl]-4-oxo-N-(pyridin-2-ylmethyl)-3H-phthalazine-1-carboxamide is sourced from PubChem (CID 60610103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).