C21H25N5OS — CID 60610244
5-tert-butyl-N-[1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 60610244) has the molecular formula C21H25N5OS and a molecular weight of 395.53 g/mol. Its IUPAC name is 5-tert-butyl-N-[1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | 5-tert-butyl-N-[1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 60610244 |
| Molecular Formula | C21H25N5OS |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 5-tert-butyl-N-[1-(pyridin-2-ylmethyl)-1,2,4-triazol-3-yl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)(C)C1CCc2sc(C(=O)Nc3ncn(Cc4ccccn4)n3)cc2C1 |
| InChI | InChI=1S/C21H25N5OS/c1-21(2,3)15-7-8-17-14(10-15)11-18(28-17)19(27)24-20-23-13-26(25-20)12-16-6-4-5-9-22-16/h4-6,9,11,13,15H,7-8,10,12H2,1-3H3,(H,24,25,27) |
| InChIKey | XWWVTMXDHXENRB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |