C17H24N4O — CID 60611272
1-benzyl-3-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-1-methylurea (PubChem CID 60611272) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 1-benzyl-3-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-1-methylurea.
| Compound Name | 1-benzyl-3-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-1-methylurea |
|---|---|
| PubChem CID | 60611272 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 1-benzyl-3-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-1-methylurea |
| SMILES | Cc1nn(C(C)C)c(C)c1NC(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C17H24N4O/c1-12(2)21-14(4)16(13(3)19-21)18-17(22)20(5)11-15-9-7-6-8-10-15/h6-10,12H,11H2,1-5H3,(H,18,22) |
| InChIKey | KXUVKKNUNBVNBG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |