C19H18F6N4O3 — CID 60612527
8-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-3-butyl-7-methylpurine-2,6-dione (PubChem CID 60612527) has the molecular formula C19H18F6N4O3 and a molecular weight of 464.37 g/mol. Its IUPAC name is 8-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-3-butyl-7-methylpurine-2,6-dione.
| Compound Name | 8-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-3-butyl-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 60612527 |
| Molecular Formula | C19H18F6N4O3 |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 8-[[3,5-bis(trifluoromethyl)phenoxy]methyl]-3-butyl-7-methylpurine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COc1cc(C(F)(F)F)cc(C(F)(F)F)c1)n2C |
| InChI | InChI=1S/C19H18F6N4O3/c1-3-4-5-29-15-14(16(30)27-17(29)31)28(2)13(26-15)9-32-12-7-10(18(20,21)22)6-11(8-12)19(23,24)25/h6-8H,3-5,9H2,1-2H3,(H,27,30,31) |
| InChIKey | PZRCSIQFNXCFCG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |