C23H29ClN2O4 — CID 60612832
N-[1-[3-(4-chlorophenyl)propylamino]-3-methyl-1-oxobutan-2-yl]-3,5-dimethoxybenzamide (PubChem CID 60612832) has the molecular formula C23H29ClN2O4 and a molecular weight of 432.95 g/mol. Its IUPAC name is N-[1-[3-(4-chlorophenyl)propylamino]-3-methyl-1-oxobutan-2-yl]-3,5-dimethoxybenzamide.
| Compound Name | N-[1-[3-(4-chlorophenyl)propylamino]-3-methyl-1-oxobutan-2-yl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 60612832 |
| Molecular Formula | C23H29ClN2O4 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N-[1-[3-(4-chlorophenyl)propylamino]-3-methyl-1-oxobutan-2-yl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC(C(=O)NCCCc2ccc(Cl)cc2)C(C)C)c1 |
| InChI | InChI=1S/C23H29ClN2O4/c1-15(2)21(23(28)25-11-5-6-16-7-9-18(24)10-8-16)26-22(27)17-12-19(29-3)14-20(13-17)30-4/h7-10,12-15,21H,5-6,11H2,1-4H3,(H,25,28)(H,26,27) |
| InChIKey | JUHKERCDXKSLGW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|