About 5-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentan-1-ol
5-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentan-1-ol (PubChem CID 60613933) has the molecular formula C17H18N2OS2
and a molecular weight of 330.48 g/mol. Its IUPAC name is 5-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentan-1-ol.
Molecular Properties
| Compound Name | 5-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentan-1-ol |
| PubChem CID | 60613933 |
| Molecular Formula | C17H18N2OS2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 5-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentan-1-ol |
| SMILES | OCCCCCSc1ncnc2sc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C17H18N2OS2/c20-9-5-2-6-10-21-16-14-11-15(13-7-3-1-4-8-13)22-17(14)19-12-18-16/h1,3-4,7-8,11-12,20H,2,5-6,9-10H2 |
| InChIKey | LWCUBBRJBFLOPA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentan-1-ol?
The IUPAC name of 5-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentan-1-ol (CID 60613933) is 5-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentan-1-ol.
What is the SMILES notation for 5-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentan-1-ol?
The canonical SMILES for 5-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentan-1-ol is OCCCCCSc1ncnc2sc(-c3ccccc3)cc12.
What is the InChIKey of 5-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentan-1-ol?
The InChIKey is LWCUBBRJBFLOPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2OS2/c20-9-5-2-6-10-21-16-14-11-15(13-7-3-1-4-8-13)22-17(14)19-12-18-16/h1,3-4,7-8,11-12,20H,2,5-6,9-10H2.
What are the key properties of 5-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentan-1-ol?
5-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentan-1-ol has a molecular weight of 330.48 g/mol, XLogP of 4.61, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylpentan-1-ol is sourced from PubChem (CID 60613933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).