C19H29N3O2S2 — CID 60613937
2-[[6-methyl-5-(2-methylbutyl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]-N-pentylacetamide (PubChem CID 60613937) has the molecular formula C19H29N3O2S2 and a molecular weight of 395.59 g/mol. Its IUPAC name is 2-[[6-methyl-5-(2-methylbutyl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]-N-pentylacetamide.
| Compound Name | 2-[[6-methyl-5-(2-methylbutyl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]-N-pentylacetamide |
|---|---|
| PubChem CID | 60613937 |
| Molecular Formula | C19H29N3O2S2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-[[6-methyl-5-(2-methylbutyl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CSc1nc2sc(C)c(CC(C)CC)c2c(=O)[nH]1 |
| InChI | InChI=1S/C19H29N3O2S2/c1-5-7-8-9-20-15(23)11-25-19-21-17(24)16-14(10-12(3)6-2)13(4)26-18(16)22-19/h12H,5-11H2,1-4H3,(H,20,23)(H,21,22,24) |
| InChIKey | ZMNNNDRJKUJZEP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|