C28H19N3O5 — CID 6061470
2-[[1-[(E)-[1-(furan-2-ylmethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]naphthalen-2-yl]oxymethyl]benzonitrile (PubChem CID 6061470) has the molecular formula C28H19N3O5 and a molecular weight of 477.48 g/mol. Its IUPAC name is 2-[[1-[(E)-[1-(furan-2-ylmethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]naphthalen-2-yl]oxymethyl]benzonitrile.
| Compound Name | 2-[[1-[(E)-[1-(furan-2-ylmethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]naphthalen-2-yl]oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 6061470 |
| Molecular Formula | C28H19N3O5 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 2-[[1-[(E)-[1-(furan-2-ylmethyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]naphthalen-2-yl]oxymethyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1ccc2ccccc2c1/C=C1\C(=O)NC(=O)N(Cc2ccco2)C1=O |
| InChI | InChI=1S/C28H19N3O5/c29-15-19-7-1-2-8-20(19)17-36-25-12-11-18-6-3-4-10-22(18)23(25)14-24-26(32)30-28(34)31(27(24)33)16-21-9-5-13-35-21/h1-14H,16-17H2,(H,30,32,34)/b24-14+ |
| InChIKey | MRDMGWHEXMHDAR-ZVHZXABRSA-N |
| XLogP | 4.55 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|