C22H22BrN3O3S — CID 60614790
N-[2-[(3-bromobenzoyl)amino]ethyl]-2-(4-ethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 60614790) has the molecular formula C22H22BrN3O3S and a molecular weight of 488.41 g/mol. Its IUPAC name is N-[2-[(3-bromobenzoyl)amino]ethyl]-2-(4-ethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[(3-bromobenzoyl)amino]ethyl]-2-(4-ethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 60614790 |
| Molecular Formula | C22H22BrN3O3S |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | N-[2-[(3-bromobenzoyl)amino]ethyl]-2-(4-ethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCOc1ccc(-c2nc(C)c(C(=O)NCCNC(=O)c3cccc(Br)c3)s2)cc1 |
| InChI | InChI=1S/C22H22BrN3O3S/c1-3-29-18-9-7-15(8-10-18)22-26-14(2)19(30-22)21(28)25-12-11-24-20(27)16-5-4-6-17(23)13-16/h4-10,13H,3,11-12H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | LDHBSJCEUYIBPL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|