C19H20F3N3O2S — CID 60616360
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 60616360) has the molecular formula C19H20F3N3O2S and a molecular weight of 411.45 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 60616360 |
| Molecular Formula | C19H20F3N3O2S |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCC1CN2CCCC2CO1)c1csc(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C19H20F3N3O2S/c20-19(21,22)13-4-1-3-12(7-13)18-24-16(11-28-18)17(26)23-8-15-9-25-6-2-5-14(25)10-27-15/h1,3-4,7,11,14-15H,2,5-6,8-10H2,(H,23,26) |
| InChIKey | QFYKAUYZBMJPIW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |